2-fluoro-N-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide
Chemical Structure Depiction of
2-fluoro-N-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide
2-fluoro-N-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide
Compound characteristics
| Compound ID: | Y205-0378 |
| Compound Name: | 2-fluoro-N-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide |
| Molecular Weight: | 390.26 |
| Molecular Formula: | C16 H11 F5 N2 O4 |
| Smiles: | C(C(C(F)F)(F)F)Oc1cc(cc(c1)[N+]([O-])=O)NC(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9408 |
| logD: | 3.1376 |
| logSw: | -4.1988 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.21 |
| InChI Key: | FIGXWDIQLZKVCL-UHFFFAOYSA-N |