N-{1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-2-phenylcyclopropane-1-carboxamide
Chemical Structure Depiction of
N-{1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-2-phenylcyclopropane-1-carboxamide
N-{1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-2-phenylcyclopropane-1-carboxamide
Compound characteristics
| Compound ID: | Y205-0404 |
| Compound Name: | N-{1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-2-phenylcyclopropane-1-carboxamide |
| Molecular Weight: | 397.88 |
| Molecular Formula: | C22 H21 Cl F N3 O |
| Smiles: | Cc1c(c(C)n(Cc2c(cccc2[Cl])F)n1)NC(C1CC1c1ccccc1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.0998 |
| logD: | 4.0973 |
| logSw: | -4.4447 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.467 |
| InChI Key: | JCCSFSVTMZGLAX-UHFFFAOYSA-N |