4-[(4-chlorophenyl)carbamamido]-N-(6-methoxypyrimidin-4-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-[(4-chlorophenyl)carbamamido]-N-(6-methoxypyrimidin-4-yl)benzene-1-sulfonamide
4-[(4-chlorophenyl)carbamamido]-N-(6-methoxypyrimidin-4-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y205-0605 |
| Compound Name: | 4-[(4-chlorophenyl)carbamamido]-N-(6-methoxypyrimidin-4-yl)benzene-1-sulfonamide |
| Molecular Weight: | 433.87 |
| Molecular Formula: | C18 H16 Cl N5 O4 S |
| Smiles: | COc1cc(NS(c2ccc(cc2)NC(Nc2ccc(cc2)[Cl])=O)(=O)=O)ncn1 |
| Stereo: | ACHIRAL |
| logP: | 3.7849 |
| logD: | 1.6331 |
| logSw: | -4.3761 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 101.012 |
| InChI Key: | QWQKZWFWRCFYAO-UHFFFAOYSA-N |