N,N'-(pyridine-2,6-diyl)bis(4-chlorobenzamide)
Chemical Structure Depiction of
N,N'-(pyridine-2,6-diyl)bis(4-chlorobenzamide)
N,N'-(pyridine-2,6-diyl)bis(4-chlorobenzamide)
Compound characteristics
| Compound ID: | Y205-0897 |
| Compound Name: | N,N'-(pyridine-2,6-diyl)bis(4-chlorobenzamide) |
| Molecular Weight: | 386.24 |
| Molecular Formula: | C19 H13 Cl2 N3 O2 |
| Smiles: | c1cc(NC(c2ccc(cc2)[Cl])=O)nc(c1)NC(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.3341 |
| logD: | 5.284 |
| logSw: | -6.1514 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.171 |
| InChI Key: | YAUIJDXPZDUIDM-UHFFFAOYSA-N |