N-(4,6-dimethylpyridin-2-yl)-N'-[2-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-(4,6-dimethylpyridin-2-yl)-N'-[2-(trifluoromethyl)phenyl]urea
N-(4,6-dimethylpyridin-2-yl)-N'-[2-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | Y205-1267 |
| Compound Name: | N-(4,6-dimethylpyridin-2-yl)-N'-[2-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 309.29 |
| Molecular Formula: | C15 H14 F3 N3 O |
| Smiles: | Cc1cc(C)nc(c1)NC(Nc1ccccc1C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0558 |
| logD: | 4.0029 |
| logSw: | -4.1334 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 40.833 |
| InChI Key: | TUGYNTXYBVQNRI-UHFFFAOYSA-N |