N-(4-acetylphenyl)-4-[(2H-1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxamide
Chemical Structure Depiction of
N-(4-acetylphenyl)-4-[(2H-1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxamide
N-(4-acetylphenyl)-4-[(2H-1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y205-1390 |
| Compound Name: | N-(4-acetylphenyl)-4-[(2H-1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxamide |
| Molecular Weight: | 381.43 |
| Molecular Formula: | C21 H23 N3 O4 |
| Smiles: | CC(c1ccc(cc1)NC(N1CCN(CC1)Cc1ccc2c(c1)OCO2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1919 |
| logD: | 1.0119 |
| logSw: | -2.9413 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.19 |
| InChI Key: | NHIGFKVXWDGEHC-UHFFFAOYSA-N |