N-(diphenylmethyl)-2,5-dimethoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-(diphenylmethyl)-2,5-dimethoxybenzene-1-sulfonamide
N-(diphenylmethyl)-2,5-dimethoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y205-1978 |
| Compound Name: | N-(diphenylmethyl)-2,5-dimethoxybenzene-1-sulfonamide |
| Molecular Weight: | 383.46 |
| Molecular Formula: | C21 H21 N O4 S |
| Smiles: | COc1ccc(c(c1)S(NC(c1ccccc1)c1ccccc1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.9713 |
| logD: | 3.97 |
| logSw: | -4.165 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.465 |
| InChI Key: | XVVQMQZHQFKJRU-UHFFFAOYSA-N |