N-(2,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carboxamide
N-(2,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y205-2514 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carboxamide |
| Molecular Weight: | 369.46 |
| Molecular Formula: | C21 H27 N3 O3 |
| Smiles: | CC1CN(CCN1c1ccc(C)cc1)C(Nc1cc(ccc1OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9526 |
| logD: | 3.9332 |
| logSw: | -3.9928 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.663 |
| InChI Key: | DVYRZNLXEALZMY-INIZCTEOSA-N |