N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-methyl-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-methyl-1-benzofuran-2-carboxamide
N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-methyl-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | Y205-3625 |
| Compound Name: | N-(3-carbamoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-methyl-1-benzofuran-2-carboxamide |
| Molecular Weight: | 368.45 |
| Molecular Formula: | C20 H20 N2 O3 S |
| Smiles: | Cc1c2ccccc2oc1C(Nc1c(C(N)=O)c2CCCCCc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6921 |
| logD: | 1.8383 |
| logSw: | -4.3597 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 65.96 |
| InChI Key: | XHPJLADANUJABU-UHFFFAOYSA-N |