(azepan-1-yl)(5-methyl-4-phenylthiophen-3-yl)methanone
Chemical Structure Depiction of
(azepan-1-yl)(5-methyl-4-phenylthiophen-3-yl)methanone
(azepan-1-yl)(5-methyl-4-phenylthiophen-3-yl)methanone
Compound characteristics
| Compound ID: | Y205-3643 |
| Compound Name: | (azepan-1-yl)(5-methyl-4-phenylthiophen-3-yl)methanone |
| Molecular Weight: | 299.43 |
| Molecular Formula: | C18 H21 N O S |
| Smiles: | Cc1c(c2ccccc2)c(cs1)C(N1CCCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.543 |
| logD: | 4.543 |
| logSw: | -4.3911 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 17.9645 |
| InChI Key: | DJPXLNUOGYAYOY-UHFFFAOYSA-N |