N-(pyrazin-2-yl)-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
N-(pyrazin-2-yl)-1-benzothiophene-3-carboxamide
N-(pyrazin-2-yl)-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | Y205-4026 |
| Compound Name: | N-(pyrazin-2-yl)-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 255.3 |
| Molecular Formula: | C13 H9 N3 O S |
| Smiles: | c1ccc2c(c1)c(cs2)C(Nc1cnccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6714 |
| logD: | 2.6713 |
| logSw: | -3.301 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.209 |
| InChI Key: | OOZUJPYLBZSMCV-UHFFFAOYSA-N |