1-[4-(4-chlorophenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one
Chemical Structure Depiction of
1-[4-(4-chlorophenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one
1-[4-(4-chlorophenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one
Compound characteristics
| Compound ID: | Y205-4422 |
| Compound Name: | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
| Molecular Weight: | 294.82 |
| Molecular Formula: | C16 H23 Cl N2 O |
| Smiles: | CC(C)(C)CC(N1CCN(CC1)c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.9302 |
| logD: | 3.9302 |
| logSw: | -4.2498 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 19.8912 |
| InChI Key: | FJENJBVFAPJZPS-UHFFFAOYSA-N |