N-(4-nitrophenyl)-4-(2-phenylethyl)piperazine-1-carboxamide
Chemical Structure Depiction of
N-(4-nitrophenyl)-4-(2-phenylethyl)piperazine-1-carboxamide
N-(4-nitrophenyl)-4-(2-phenylethyl)piperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y205-4567 |
| Compound Name: | N-(4-nitrophenyl)-4-(2-phenylethyl)piperazine-1-carboxamide |
| Molecular Weight: | 354.41 |
| Molecular Formula: | C19 H22 N4 O3 |
| Smiles: | C(CN1CCN(CC1)C(Nc1ccc(cc1)[N+]([O-])=O)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 2.9606 |
| logD: | 2.5076 |
| logSw: | -3.5131 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.608 |
| InChI Key: | XAASGHUVBZPOLC-UHFFFAOYSA-N |