3-{[3-carbamoyl-4-(4-fluorophenyl)-5-methylthiophen-2-yl]carbamoyl}bicyclo[2.2.1]heptane-2-carboxylic acid
Chemical Structure Depiction of
3-{[3-carbamoyl-4-(4-fluorophenyl)-5-methylthiophen-2-yl]carbamoyl}bicyclo[2.2.1]heptane-2-carboxylic acid
3-{[3-carbamoyl-4-(4-fluorophenyl)-5-methylthiophen-2-yl]carbamoyl}bicyclo[2.2.1]heptane-2-carboxylic acid
Compound characteristics
| Compound ID: | Y205-5283 |
| Compound Name: | 3-{[3-carbamoyl-4-(4-fluorophenyl)-5-methylthiophen-2-yl]carbamoyl}bicyclo[2.2.1]heptane-2-carboxylic acid |
| Molecular Weight: | 416.47 |
| Molecular Formula: | C21 H21 F N2 O4 S |
| Smiles: | Cc1c(c2ccc(cc2)F)c(C(N)=O)c(NC(C2C3CCC(C3)C2C(O)=O)=O)s1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.1305 |
| logD: | -0.4896 |
| logSw: | -2.6884 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 86.164 |
| InChI Key: | LCNOIVZFZCBWSU-UHFFFAOYSA-N |