6-chloro-N-(1-phenylpropyl)-2-(pyridin-4-yl)quinoline-4-carboxamide
Chemical Structure Depiction of
6-chloro-N-(1-phenylpropyl)-2-(pyridin-4-yl)quinoline-4-carboxamide
6-chloro-N-(1-phenylpropyl)-2-(pyridin-4-yl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y205-5480 |
| Compound Name: | 6-chloro-N-(1-phenylpropyl)-2-(pyridin-4-yl)quinoline-4-carboxamide |
| Molecular Weight: | 401.89 |
| Molecular Formula: | C24 H20 Cl N3 O |
| Smiles: | CCC(c1ccccc1)NC(c1cc(c2ccncc2)nc2ccc(cc12)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1342 |
| logD: | 6.1332 |
| logSw: | -6.1194 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.77 |
| InChI Key: | RPSPVXQWPXBRIM-NRFANRHFSA-N |