7-{[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl}-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
Chemical Structure Depiction of
7-{[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl}-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
7-{[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl}-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
Compound characteristics
| Compound ID: | Y205-6130 |
| Compound Name: | 7-{[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl}-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| Molecular Weight: | 374.89 |
| Molecular Formula: | C18 H19 Cl N4 O S |
| Smiles: | Cc1ccc(cc1N1CCN(CC1)CC1=CC(N2C=CSC2=N1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.5846 |
| logD: | 2.3685 |
| logSw: | -3.143 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.886 |
| InChI Key: | OYGHUJBAZCDWMC-UHFFFAOYSA-N |