N-(2,6-dimethylphenyl)-N'-(2-methoxy-5-methylphenyl)urea
Chemical Structure Depiction of
N-(2,6-dimethylphenyl)-N'-(2-methoxy-5-methylphenyl)urea
N-(2,6-dimethylphenyl)-N'-(2-methoxy-5-methylphenyl)urea
Compound characteristics
| Compound ID: | Y205-6785 |
| Compound Name: | N-(2,6-dimethylphenyl)-N'-(2-methoxy-5-methylphenyl)urea |
| Molecular Weight: | 284.36 |
| Molecular Formula: | C17 H20 N2 O2 |
| Smiles: | Cc1ccc(c(c1)NC(Nc1c(C)cccc1C)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.6621 |
| logD: | 3.6621 |
| logSw: | -3.7186 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 38.078 |
| InChI Key: | SWUUBMCIWTUEKA-UHFFFAOYSA-N |