2-bromo-N-[4-(piperidine-1-carbonyl)phenyl]benzamide
Chemical Structure Depiction of
2-bromo-N-[4-(piperidine-1-carbonyl)phenyl]benzamide
2-bromo-N-[4-(piperidine-1-carbonyl)phenyl]benzamide
Compound characteristics
| Compound ID: | Y205-8304 |
| Compound Name: | 2-bromo-N-[4-(piperidine-1-carbonyl)phenyl]benzamide |
| Molecular Weight: | 387.27 |
| Molecular Formula: | C19 H19 Br N2 O2 |
| Smiles: | C1CCN(CC1)C(c1ccc(cc1)NC(c1ccccc1[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2423 |
| logD: | 3.1595 |
| logSw: | -3.7411 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.978 |
| InChI Key: | BDRVUWSPPJIZMP-UHFFFAOYSA-N |