1-(3,4-dimethoxybenzene-1-sulfonyl)-4-[(4-methoxyphenyl)methyl]piperazine
Chemical Structure Depiction of
1-(3,4-dimethoxybenzene-1-sulfonyl)-4-[(4-methoxyphenyl)methyl]piperazine
1-(3,4-dimethoxybenzene-1-sulfonyl)-4-[(4-methoxyphenyl)methyl]piperazine
Compound characteristics
| Compound ID: | Y205-8665 |
| Compound Name: | 1-(3,4-dimethoxybenzene-1-sulfonyl)-4-[(4-methoxyphenyl)methyl]piperazine |
| Molecular Weight: | 406.5 |
| Molecular Formula: | C20 H26 N2 O5 S |
| Smiles: | COc1ccc(CN2CCN(CC2)S(c2ccc(c(c2)OC)OC)(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.2783 |
| logD: | 2.2745 |
| logSw: | -2.7074 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 58.294 |
| InChI Key: | IKBUKIRTPYOETP-UHFFFAOYSA-N |