3-phenoxy-N-[(pyridin-2-yl)methyl]benzamide
Chemical Structure Depiction of
3-phenoxy-N-[(pyridin-2-yl)methyl]benzamide
3-phenoxy-N-[(pyridin-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | Y205-9220 |
| Compound Name: | 3-phenoxy-N-[(pyridin-2-yl)methyl]benzamide |
| Molecular Weight: | 304.35 |
| Molecular Formula: | C19 H16 N2 O2 |
| Smiles: | C(c1ccccn1)NC(c1cccc(c1)Oc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4617 |
| logD: | 3.4616 |
| logSw: | -3.7854 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.943 |
| InChI Key: | CHEOLCKGBKAXGM-UHFFFAOYSA-N |