3-phenoxy-N-[2-(piperidin-1-yl)ethyl]benzamide
Chemical Structure Depiction of
3-phenoxy-N-[2-(piperidin-1-yl)ethyl]benzamide
3-phenoxy-N-[2-(piperidin-1-yl)ethyl]benzamide
Compound characteristics
| Compound ID: | Y205-9224 |
| Compound Name: | 3-phenoxy-N-[2-(piperidin-1-yl)ethyl]benzamide |
| Molecular Weight: | 324.42 |
| Molecular Formula: | C20 H24 N2 O2 |
| Smiles: | C1CCN(CC1)CCNC(c1cccc(c1)Oc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5508 |
| logD: | 2.551 |
| logSw: | -3.712 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.223 |
| InChI Key: | VYBVFBRHHWUICH-UHFFFAOYSA-N |