2-{[4-methyl-5-(pyridin-3-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1-phenylethyl)acetamide
Chemical Structure Depiction of
2-{[4-methyl-5-(pyridin-3-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1-phenylethyl)acetamide
2-{[4-methyl-5-(pyridin-3-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1-phenylethyl)acetamide
Compound characteristics
| Compound ID: | Y205-9372 |
| Compound Name: | 2-{[4-methyl-5-(pyridin-3-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1-phenylethyl)acetamide |
| Molecular Weight: | 353.44 |
| Molecular Formula: | C18 H19 N5 O S |
| Smiles: | CC(c1ccccc1)NC(CSc1nnc(c2cccnc2)n1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.6431 |
| logD: | 1.6091 |
| logSw: | -1.7029 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.203 |
| InChI Key: | NXPTWWFNOLQFDI-ZDUSSCGKSA-N |