N-(2,4-difluorophenyl)-N'-(2,4,6-trimethylphenyl)urea
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-N'-(2,4,6-trimethylphenyl)urea
N-(2,4-difluorophenyl)-N'-(2,4,6-trimethylphenyl)urea
Compound characteristics
| Compound ID: | Y205-9701 |
| Compound Name: | N-(2,4-difluorophenyl)-N'-(2,4,6-trimethylphenyl)urea |
| Molecular Weight: | 290.31 |
| Molecular Formula: | C16 H16 F2 N2 O |
| Smiles: | Cc1cc(C)c(c(C)c1)NC(Nc1ccc(cc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0697 |
| logD: | 4.0553 |
| logSw: | -4.0146 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 30.4479 |
| InChI Key: | QCJYLQLLRZMHSL-UHFFFAOYSA-N |