N-(4-methoxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)urea
Chemical Structure Depiction of
N-(4-methoxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)urea
N-(4-methoxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)urea
Compound characteristics
| Compound ID: | Y206-0200 |
| Compound Name: | N-(4-methoxyphenyl)-N'-(5-methyl-1,2-oxazol-3-yl)urea |
| Molecular Weight: | 247.25 |
| Molecular Formula: | C12 H13 N3 O3 |
| Smiles: | Cc1cc(NC(Nc2ccc(cc2)OC)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 2.9385 |
| logD: | 2.9357 |
| logSw: | -3.5659 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.881 |
| InChI Key: | IFLQTZIPWLCZOG-UHFFFAOYSA-N |