5-chloro-N-[4-(dimethylsulfamoyl)phenyl]thiophene-2-carboxamide
Chemical Structure Depiction of
5-chloro-N-[4-(dimethylsulfamoyl)phenyl]thiophene-2-carboxamide
5-chloro-N-[4-(dimethylsulfamoyl)phenyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y206-0583 |
| Compound Name: | 5-chloro-N-[4-(dimethylsulfamoyl)phenyl]thiophene-2-carboxamide |
| Molecular Weight: | 344.84 |
| Molecular Formula: | C13 H13 Cl N2 O3 S2 |
| Smiles: | CN(C)S(c1ccc(cc1)NC(c1ccc(s1)[Cl])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0632 |
| logD: | 2.9257 |
| logSw: | -3.7758 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.012 |
| InChI Key: | JWPOGCHTKVWNDR-UHFFFAOYSA-N |