N-(4-fluorophenyl)-N'-[(2-methoxyphenyl)methyl]urea
Chemical Structure Depiction of
N-(4-fluorophenyl)-N'-[(2-methoxyphenyl)methyl]urea
N-(4-fluorophenyl)-N'-[(2-methoxyphenyl)methyl]urea
Compound characteristics
| Compound ID: | Y206-0625 |
| Compound Name: | N-(4-fluorophenyl)-N'-[(2-methoxyphenyl)methyl]urea |
| Molecular Weight: | 274.29 |
| Molecular Formula: | C15 H15 F N2 O2 |
| Smiles: | COc1ccccc1CNC(Nc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1383 |
| logD: | 3.1383 |
| logSw: | -3.4829 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.494 |
| InChI Key: | UBLUXJDPDKLVRU-UHFFFAOYSA-N |