N-(2,5-dimethylphenyl)-N'-(2-phenylethyl)urea
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-N'-(2-phenylethyl)urea
N-(2,5-dimethylphenyl)-N'-(2-phenylethyl)urea
Compound characteristics
| Compound ID: | Y206-2033 |
| Compound Name: | N-(2,5-dimethylphenyl)-N'-(2-phenylethyl)urea |
| Molecular Weight: | 268.36 |
| Molecular Formula: | C17 H20 N2 O |
| Smiles: | Cc1ccc(C)c(c1)NC(NCCc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1056 |
| logD: | 3.1056 |
| logSw: | -3.2617 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 33.007 |
| InChI Key: | VNSHZUDBKBEPSY-UHFFFAOYSA-N |