N-(2,4-difluorophenyl)-N'-(2,5-dimethylphenyl)urea
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-N'-(2,5-dimethylphenyl)urea
N-(2,4-difluorophenyl)-N'-(2,5-dimethylphenyl)urea
Compound characteristics
| Compound ID: | Y206-3008 |
| Compound Name: | N-(2,4-difluorophenyl)-N'-(2,5-dimethylphenyl)urea |
| Molecular Weight: | 276.28 |
| Molecular Formula: | C15 H14 F2 N2 O |
| Smiles: | Cc1ccc(C)c(c1)NC(Nc1ccc(cc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6304 |
| logD: | 3.6296 |
| logSw: | -3.6222 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 31.1458 |
| InChI Key: | APMMYGSTYHKBLV-UHFFFAOYSA-N |