N-(2-bromo-4-methylphenyl)-N'-(3-chloro-4-methylphenyl)urea
Chemical Structure Depiction of
N-(2-bromo-4-methylphenyl)-N'-(3-chloro-4-methylphenyl)urea
N-(2-bromo-4-methylphenyl)-N'-(3-chloro-4-methylphenyl)urea
Compound characteristics
| Compound ID: | Y206-3019 |
| Compound Name: | N-(2-bromo-4-methylphenyl)-N'-(3-chloro-4-methylphenyl)urea |
| Molecular Weight: | 353.64 |
| Molecular Formula: | C15 H14 Br Cl N2 O |
| Smiles: | Cc1ccc(c(c1)[Br])NC(Nc1ccc(C)c(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.844 |
| logD: | 5.8437 |
| logSw: | -6.0317 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 31.844 |
| InChI Key: | LUWAPJCKPWLOJX-UHFFFAOYSA-N |