2-(3-chloro-4-fluorophenoxy)-1-[4-(prop-2-en-1-yl)piperazin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(3-chloro-4-fluorophenoxy)-1-[4-(prop-2-en-1-yl)piperazin-1-yl]ethan-1-one
2-(3-chloro-4-fluorophenoxy)-1-[4-(prop-2-en-1-yl)piperazin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | Y206-3186 |
| Compound Name: | 2-(3-chloro-4-fluorophenoxy)-1-[4-(prop-2-en-1-yl)piperazin-1-yl]ethan-1-one |
| Molecular Weight: | 312.77 |
| Molecular Formula: | C15 H18 Cl F N2 O2 |
| Smiles: | C=CCN1CCN(CC1)C(COc1ccc(c(c1)[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8924 |
| logD: | 1.8216 |
| logSw: | -2.701 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 27.6488 |
| InChI Key: | YAMSBKDKRMLPFA-UHFFFAOYSA-N |