N-[2-methyl-6-(propan-2-yl)phenyl]-N'-propylurea
Chemical Structure Depiction of
N-[2-methyl-6-(propan-2-yl)phenyl]-N'-propylurea
N-[2-methyl-6-(propan-2-yl)phenyl]-N'-propylurea
Compound characteristics
| Compound ID: | Y206-3207 |
| Compound Name: | N-[2-methyl-6-(propan-2-yl)phenyl]-N'-propylurea |
| Molecular Weight: | 234.34 |
| Molecular Formula: | C14 H22 N2 O |
| Smiles: | CCCNC(Nc1c(C)cccc1C(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9293 |
| logD: | 2.9293 |
| logSw: | -2.9187 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 32.581 |
| InChI Key: | VPLBQFIBKUBQOB-UHFFFAOYSA-N |