2-(3-methylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-(3-methylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide
2-(3-methylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | Y206-3672 |
| Compound Name: | 2-(3-methylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 300.32 |
| Molecular Formula: | C15 H19 F3 N2 O |
| Smiles: | CC1CCCN(C1)CC(Nc1ccccc1C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4783 |
| logD: | 3.2906 |
| logSw: | -3.7372 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.356 |
| InChI Key: | KJDAKHDVJAEFBQ-NSHDSACASA-N |