N-{4-[(2,4-dimethylbenzene-1-sulfonyl)amino]phenyl}-N-methylacetamide
Chemical Structure Depiction of
N-{4-[(2,4-dimethylbenzene-1-sulfonyl)amino]phenyl}-N-methylacetamide
N-{4-[(2,4-dimethylbenzene-1-sulfonyl)amino]phenyl}-N-methylacetamide
Compound characteristics
| Compound ID: | Y206-5064 |
| Compound Name: | N-{4-[(2,4-dimethylbenzene-1-sulfonyl)amino]phenyl}-N-methylacetamide |
| Molecular Weight: | 332.42 |
| Molecular Formula: | C17 H20 N2 O3 S |
| Smiles: | CC(N(C)c1ccc(cc1)NS(c1ccc(C)cc1C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5791 |
| logD: | 2.4588 |
| logSw: | -2.9832 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.996 |
| InChI Key: | JPEHBJUJMJJYQE-UHFFFAOYSA-N |