2-[4-(4-chlorophenyl)piperazin-1-yl]-N-[(furan-2-yl)methyl]acetamide
Chemical Structure Depiction of
2-[4-(4-chlorophenyl)piperazin-1-yl]-N-[(furan-2-yl)methyl]acetamide
2-[4-(4-chlorophenyl)piperazin-1-yl]-N-[(furan-2-yl)methyl]acetamide
Compound characteristics
| Compound ID: | Y206-5405 |
| Compound Name: | 2-[4-(4-chlorophenyl)piperazin-1-yl]-N-[(furan-2-yl)methyl]acetamide |
| Molecular Weight: | 333.82 |
| Molecular Formula: | C17 H20 Cl N3 O2 |
| Smiles: | C(c1ccco1)NC(CN1CCN(CC1)c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.3688 |
| logD: | 3.3665 |
| logSw: | -3.591 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.452 |
| InChI Key: | QUNRHWQWYUGOCF-UHFFFAOYSA-N |