2,6-dimethyl-4-{[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl}morpholine
Chemical Structure Depiction of
2,6-dimethyl-4-{[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl}morpholine
2,6-dimethyl-4-{[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl}morpholine
Compound characteristics
| Compound ID: | Y206-5704 |
| Compound Name: | 2,6-dimethyl-4-{[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl}morpholine |
| Molecular Weight: | 302.44 |
| Molecular Formula: | C17 H22 N2 O S |
| Smiles: | CC1CN(CC(C)O1)Cc1csc(c2cccc(C)c2)n1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.4311 |
| logD: | 3.4307 |
| logSw: | -3.6015 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 21.1326 |
| InChI Key: | QXFXTTXEZXRDNW-UHFFFAOYSA-N |