4-[(4-butoxyphenyl)methyl]-N-(4-chlorophenyl)piperazine-1-carboxamide
Chemical Structure Depiction of
4-[(4-butoxyphenyl)methyl]-N-(4-chlorophenyl)piperazine-1-carboxamide
4-[(4-butoxyphenyl)methyl]-N-(4-chlorophenyl)piperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y206-5962 |
| Compound Name: | 4-[(4-butoxyphenyl)methyl]-N-(4-chlorophenyl)piperazine-1-carboxamide |
| Molecular Weight: | 401.94 |
| Molecular Formula: | C22 H28 Cl N3 O2 |
| Smiles: | CCCCOc1ccc(CN2CCN(CC2)C(Nc2ccc(cc2)[Cl])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8056 |
| logD: | 4.628 |
| logSw: | -4.6613 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.666 |
| InChI Key: | YFMIKZQYKGIKQI-UHFFFAOYSA-N |