4-(2-phenylethyl)-N-propylpiperazine-1-carboxamide
Chemical Structure Depiction of
4-(2-phenylethyl)-N-propylpiperazine-1-carboxamide
4-(2-phenylethyl)-N-propylpiperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y206-6121 |
| Compound Name: | 4-(2-phenylethyl)-N-propylpiperazine-1-carboxamide |
| Molecular Weight: | 275.39 |
| Molecular Formula: | C16 H25 N3 O |
| Smiles: | CCCNC(N1CCN(CCc2ccccc2)CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3713 |
| logD: | 1.62 |
| logSw: | -2.6324 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.6615 |
| InChI Key: | RWFQKXQWKMVEMY-UHFFFAOYSA-N |