N-(4-tert-butylcyclohexyl)-2-{4-[(4-methylphenyl)methyl]piperazin-1-yl}acetamide
Chemical Structure Depiction of
N-(4-tert-butylcyclohexyl)-2-{4-[(4-methylphenyl)methyl]piperazin-1-yl}acetamide
N-(4-tert-butylcyclohexyl)-2-{4-[(4-methylphenyl)methyl]piperazin-1-yl}acetamide
Compound characteristics
| Compound ID: | Y206-6328 |
| Compound Name: | N-(4-tert-butylcyclohexyl)-2-{4-[(4-methylphenyl)methyl]piperazin-1-yl}acetamide |
| Molecular Weight: | 385.59 |
| Molecular Formula: | C24 H39 N3 O |
| Smiles: | Cc1ccc(CN2CCN(CC2)CC(NC2CCC(CC2)C(C)(C)C)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0521 |
| logD: | 4.6886 |
| logSw: | -4.4944 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.708 |
| InChI Key: | GDOVKSQJADKGTJ-UHFFFAOYSA-N |