3-(4-methoxyphenyl)-1-(1H-pyrazol-1-yl)propan-1-one
Chemical Structure Depiction of
3-(4-methoxyphenyl)-1-(1H-pyrazol-1-yl)propan-1-one
3-(4-methoxyphenyl)-1-(1H-pyrazol-1-yl)propan-1-one
Compound characteristics
| Compound ID: | Y206-6543 |
| Compound Name: | 3-(4-methoxyphenyl)-1-(1H-pyrazol-1-yl)propan-1-one |
| Molecular Weight: | 230.26 |
| Molecular Formula: | C13 H14 N2 O2 |
| Smiles: | COc1ccc(CCC(n2cccn2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.8835 |
| logD: | 1.8835 |
| logSw: | -2.0403 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.826 |
| InChI Key: | YREVIFORDIJATL-UHFFFAOYSA-N |