N-[(3-bromophenyl)methyl]-2,5-difluorobenzene-1-sulfonamide
Chemical Structure Depiction of
N-[(3-bromophenyl)methyl]-2,5-difluorobenzene-1-sulfonamide
N-[(3-bromophenyl)methyl]-2,5-difluorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y206-6590 |
| Compound Name: | N-[(3-bromophenyl)methyl]-2,5-difluorobenzene-1-sulfonamide |
| Molecular Weight: | 362.19 |
| Molecular Formula: | C13 H10 Br F2 N O2 S |
| Smiles: | C(c1cccc(c1)[Br])NS(c1cc(ccc1F)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7001 |
| logD: | 3.6998 |
| logSw: | -4.0426 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.997 |
| InChI Key: | GXEIDVVWVFFKLE-UHFFFAOYSA-N |