2,3-dichloro-N-(4,6-dimethylpyridin-2-yl)benzamide
Chemical Structure Depiction of
2,3-dichloro-N-(4,6-dimethylpyridin-2-yl)benzamide
2,3-dichloro-N-(4,6-dimethylpyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | Y206-6655 |
| Compound Name: | 2,3-dichloro-N-(4,6-dimethylpyridin-2-yl)benzamide |
| Molecular Weight: | 295.17 |
| Molecular Formula: | C14 H12 Cl2 N2 O |
| Smiles: | Cc1cc(C)nc(c1)NC(c1cccc(c1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.3578 |
| logD: | 4.2186 |
| logSw: | -4.5927 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.319 |
| InChI Key: | FMHDNLJGPCXNCZ-UHFFFAOYSA-N |