N-(3-chloro-4-methylphenyl)-4-[(pyridin-2-yl)methyl]piperazine-1-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-4-[(pyridin-2-yl)methyl]piperazine-1-carboxamide
N-(3-chloro-4-methylphenyl)-4-[(pyridin-2-yl)methyl]piperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y206-7002 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-4-[(pyridin-2-yl)methyl]piperazine-1-carboxamide |
| Molecular Weight: | 344.84 |
| Molecular Formula: | C18 H21 Cl N4 O |
| Smiles: | Cc1ccc(cc1[Cl])NC(N1CCN(CC1)Cc1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0366 |
| logD: | 2.9657 |
| logSw: | -3.3659 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.791 |
| InChI Key: | LUMBOCDCADUUFC-UHFFFAOYSA-N |