(4-bromothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(4-bromothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone
(4-bromothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | Y206-7707 |
| Compound Name: | (4-bromothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 381.29 |
| Molecular Formula: | C16 H17 Br N2 O2 S |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(c1cc(cs1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.8164 |
| logD: | 3.8163 |
| logSw: | -3.9984 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.7092 |
| InChI Key: | NZYKVRKVEASMSF-UHFFFAOYSA-N |