2-(4-bromo-2-chlorophenoxy)-N-(1-ethylpiperidin-4-yl)propanamide
Chemical Structure Depiction of
2-(4-bromo-2-chlorophenoxy)-N-(1-ethylpiperidin-4-yl)propanamide
2-(4-bromo-2-chlorophenoxy)-N-(1-ethylpiperidin-4-yl)propanamide
Compound characteristics
| Compound ID: | Y206-7815 |
| Compound Name: | 2-(4-bromo-2-chlorophenoxy)-N-(1-ethylpiperidin-4-yl)propanamide |
| Molecular Weight: | 389.72 |
| Molecular Formula: | C16 H22 Br Cl N2 O2 |
| Smiles: | CCN1CCC(CC1)NC(C(C)Oc1ccc(cc1[Cl])[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6327 |
| logD: | 0.945 |
| logSw: | -3.7931 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.79 |
| InChI Key: | AQJKIMWWLRDZTQ-NSHDSACASA-N |