propan-2-yl 4-[(cyclopentanecarbonyl)amino]benzoate
Chemical Structure Depiction of
propan-2-yl 4-[(cyclopentanecarbonyl)amino]benzoate
propan-2-yl 4-[(cyclopentanecarbonyl)amino]benzoate
Compound characteristics
| Compound ID: | Y206-8183 |
| Compound Name: | propan-2-yl 4-[(cyclopentanecarbonyl)amino]benzoate |
| Molecular Weight: | 275.35 |
| Molecular Formula: | C16 H21 N O3 |
| Smiles: | CC(C)OC(c1ccc(cc1)NC(C1CCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4859 |
| logD: | 3.4854 |
| logSw: | -3.6133 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.32 |
| InChI Key: | PCJXGLBTLUROSH-UHFFFAOYSA-N |