4-ethyl-2-[2-(2-fluorophenyl)acetamido]-5-methylthiophene-3-carboxamide
Chemical Structure Depiction of
4-ethyl-2-[2-(2-fluorophenyl)acetamido]-5-methylthiophene-3-carboxamide
4-ethyl-2-[2-(2-fluorophenyl)acetamido]-5-methylthiophene-3-carboxamide
Compound characteristics
| Compound ID: | Y206-8393 |
| Compound Name: | 4-ethyl-2-[2-(2-fluorophenyl)acetamido]-5-methylthiophene-3-carboxamide |
| Molecular Weight: | 320.38 |
| Molecular Formula: | C16 H17 F N2 O2 S |
| Smiles: | CCc1c(C(N)=O)c(NC(Cc2ccccc2F)=O)sc1C |
| Stereo: | ACHIRAL |
| logP: | 2.2663 |
| logD: | 1.4882 |
| logSw: | -2.7957 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 56.969 |
| InChI Key: | SCBZGYPKLDIWBS-UHFFFAOYSA-N |