N-{1-[4-(butan-2-yl)phenyl]ethyl}-5-methyl-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-{1-[4-(butan-2-yl)phenyl]ethyl}-5-methyl-1,2-oxazole-3-carboxamide
N-{1-[4-(butan-2-yl)phenyl]ethyl}-5-methyl-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | Y206-8943 |
| Compound Name: | N-{1-[4-(butan-2-yl)phenyl]ethyl}-5-methyl-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 286.37 |
| Molecular Formula: | C17 H22 N2 O2 |
| Smiles: | CCC(C)c1ccc(cc1)C(C)NC(c1cc(C)on1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.2893 |
| logD: | 4.2893 |
| logSw: | -4.1686 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.043 |
| InChI Key: | APRHFYORWSIPMP-UHFFFAOYSA-N |