2-(2,3-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)propanamide
Chemical Structure Depiction of
2-(2,3-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)propanamide
2-(2,3-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)propanamide
Compound characteristics
| Compound ID: | Y206-9257 |
| Compound Name: | 2-(2,3-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| Molecular Weight: | 290.38 |
| Molecular Formula: | C15 H18 N2 O2 S |
| Smiles: | CC(C(Nc1ncc(C)s1)=O)Oc1cccc(C)c1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4887 |
| logD: | 4.474 |
| logSw: | -4.2046 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.773 |
| InChI Key: | ZBZHBJDVYAXMNS-LBPRGKRZSA-N |