4-nitro-N-[1-(thiophen-2-yl)ethyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-nitro-N-[1-(thiophen-2-yl)ethyl]benzene-1-sulfonamide
4-nitro-N-[1-(thiophen-2-yl)ethyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y206-9371 |
| Compound Name: | 4-nitro-N-[1-(thiophen-2-yl)ethyl]benzene-1-sulfonamide |
| Molecular Weight: | 312.36 |
| Molecular Formula: | C12 H12 N2 O4 S2 |
| Smiles: | CC(c1cccs1)NS(c1ccc(cc1)[N+]([O-])=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8308 |
| logD: | 2.8263 |
| logSw: | -3.5692 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.773 |
| InChI Key: | NQLJUEXAJAQYFK-VIFPVBQESA-N |