cyclopropyl[4-(4-methoxybenzene-1-sulfonyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
cyclopropyl[4-(4-methoxybenzene-1-sulfonyl)piperazin-1-yl]methanone
cyclopropyl[4-(4-methoxybenzene-1-sulfonyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | Y206-9805 |
| Compound Name: | cyclopropyl[4-(4-methoxybenzene-1-sulfonyl)piperazin-1-yl]methanone |
| Molecular Weight: | 324.4 |
| Molecular Formula: | C15 H20 N2 O4 S |
| Smiles: | COc1ccc(cc1)S(N1CCN(CC1)C(C1CC1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5873 |
| logD: | 1.5873 |
| logSw: | -2.4581 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.472 |
| InChI Key: | JSCHSMXAVRXNTF-UHFFFAOYSA-N |